|
CAS#: 918149-72-1 Product: (3R)-3-(4-Methoxyphenyl)-4-pentenoic acid No suppilers available for the product. |
| Name | (3R)-3-(4-Methoxyphenyl)-4-pentenoic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 |
| CAS Registry Number | 918149-72-1 |
| SMILES | O=C(O)C[C@@H](c1ccc(OC)cc1)\C=C |
| InChI | 1S/C12H14O3/c1-3-9(8-12(13)14)10-4-6-11(15-2)7-5-10/h3-7,9H,1,8H2,2H3,(H,13,14)/t9-/m0/s1 |
| InChIKey | UDGQZNQOSUOHQP-VIFPVBQESA-N |
| Density | 1.107g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.881°C at 760 mmHg (Cal.) |
| Flash point | 129.354°C (Cal.) |
| Refractive index | 1.531 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3R)-3-(4-Methoxyphenyl)-4-pentenoic acid |