|
CAS#: 918952-57-5 Product: 2',2'-Dimethylspiro[3,6-dioxabicyclo[3.1.0]hexane-2,5'-[1,3]dioxane] No suppilers available for the product. |
| Name | 2',2'-Dimethylspiro[3,6-dioxabicyclo[3.1.0]hexane-2,5'-[1,3]dioxane] |
|---|---|
| Synonyms | 2',2'-Dim |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 |
| CAS Registry Number | 918952-57-5 |
| SMILES | CC1(OCC2(CO1)C3C(O3)CO2)C |
| InChI | 1S/C9H14O4/c1-8(2)11-4-9(5-12-8)7-6(13-7)3-10-9/h6-7H,3-5H2,1-2H3 |
| InChIKey | XHCCSTOTCORPEU-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 259.3±35.0°C at 760 mmHg (Cal.) |
| Flash point | 116.9±32.8°C (Cal.) |
| Refractive index | 1.512 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2',2'-Dimethylspiro[3,6-dioxabicyclo[3.1.0]hexane-2,5'-[1,3]dioxane] |