|
CAS#: 919101-04-5 Product: 6-Phenyl-2-(3-phenyl-2-aziridinyl)-3-oxa-1-azabicyclo[3.1.0]hexan-4-ol No suppilers available for the product. |
| Name | 6-Phenyl-2-(3-phenyl-2-aziridinyl)-3-oxa-1-azabicyclo[3.1.0]hexan-4-ol |
|---|---|
| Synonyms | 3-Oxa-1-a |
| Molecular Structure | ![]() |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 |
| CAS Registry Number | 919101-04-5 |
| SMILES | c1ccc(cc1)C2C(N2)C3N4C(C4C(O3)O)c5ccccc5 |
| InChI | 1S/C18H18N2O2/c21-18-16-15(12-9-5-2-6-10-12)20(16)17(22-18)14-13(19-14)11-7-3-1-4-8-11/h1-10,13-19,21H |
| InChIKey | GLGAFLIVZSLLEI-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.7±45.0°C at 760 mmHg (Cal.) |
| Flash point | 245.7±28.7°C (Cal.) |
| Refractive index | 1.714 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 6-Phenyl-2-(3-phenyl-2-aziridinyl)-3-oxa-1-azabicyclo[3.1.0]hexan-4-ol |