|
CAS#: 919119-70-3 Product: 7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trimethylsilyl)-1H-indole No suppilers available for the product. |
| Name | 7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trimethylsilyl)-1H-indole |
|---|---|
| Synonyms | 1H-Indole |
| Molecular Structure | ![]() |
| Molecular Formula | C17H26BNO2Si |
| Molecular Weight | 315.29 |
| CAS Registry Number | 919119-70-3 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)c2cccc3c2[nH]c(c3)[Si](C)(C)C |
| InChI | 1S/C17H26BNO2Si/c1-16(2)17(3,4)21-18(20-16)13-10-8-9-12-11-14(19-15(12)13)22(5,6)7/h8-11,19H,1-7H3 |
| InChIKey | DYUKBTITVHRVLS-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 438.3±25.0°C at 760 mmHg (Cal.) |
| Flash point | 218.9±23.2°C (Cal.) |
| Refractive index | 1.531 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trimethylsilyl)-1H-indole |