|
CAS#: 91912-10-6 Product: (3-Chlorophenyl)(Trichloromethyl) Sulfide No suppilers available for the product. |
| Name | (3-Chlorophenyl)(Trichloromethyl) Sulfide |
|---|---|
| Synonyms | 1-Chloro-3-(Trichloromethylthio)Benzene; Nsc65972 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H4Cl4S |
| Molecular Weight | 261.98 |
| CAS Registry Number | 91912-10-6 |
| SMILES | C1=CC=C(Cl)C=C1SC(Cl)(Cl)Cl |
| InChI | 1S/C7H4Cl4S/c8-5-2-1-3-6(4-5)12-7(9,10)11/h1-4H |
| InChIKey | IDIYVHNEJVLEBV-UHFFFAOYSA-N |
| Density | 1.57g/cm3 (Cal.) |
|---|---|
| Boiling point | 231.284°C at 760 mmHg (Cal.) |
| Flash point | 94.531°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3-Chlorophenyl)(Trichloromethyl) Sulfide |