|
CAS#: 91920-19-3 Product: 2-Chloro-6-(4-Chlorophenyl)-3-(4-Methylphenyl)-1-Oxa-3-Aza-2lambda5-Pho Sphacyclohex-5-Ene 2-Oxide No suppilers available for the product. |
| Name | 2-Chloro-6-(4-Chlorophenyl)-3-(4-Methylphenyl)-1-Oxa-3-Aza-2lambda5-Pho Sphacyclohex-5-Ene 2-Oxide |
|---|---|
| Synonyms | Nsc359882 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14Cl2NO2P |
| Molecular Weight | 354.17 |
| CAS Registry Number | 91920-19-3 |
| SMILES | C1=CC(=CC=C1C)N2CC=C(O[P]2(=O)Cl)C3=CC=C(C=C3)Cl |
| InChI | 1S/C16H14Cl2NO2P/c1-12-2-8-15(9-3-12)19-11-10-16(21-22(19,18)20)13-4-6-14(17)7-5-13/h2-10H,11H2,1H3 |
| InChIKey | TVLAXLGLRXMJTC-UHFFFAOYSA-N |
| Density | 1.413g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.965°C at 760 mmHg (Cal.) |
| Flash point | 242.865°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-6-(4-Chlorophenyl)-3-(4-Methylphenyl)-1-Oxa-3-Aza-2lambda5-Pho Sphacyclohex-5-Ene 2-Oxide |