|
CAS#: 919-38-0 Product: Phosphorodithioic acid S-[1-(methoxycarbonyl)ethyl] O,O-diethyl ester No suppilers available for the product. |
| Name | Phosphorodithioic acid S-[1-(methoxycarbonyl)ethyl] O,O-diethyl ester |
|---|---|
| Synonyms | 2-(Diethoxyphosphinothioylthio)Propanoic Acid Methyl Ester; 2-(Diethoxythiophosphorylthio)Propionic Acid Methyl Ester; Methyl Methprothion |
| Molecular Structure | ![]() |
| Molecular Formula | C8H17O4PS2 |
| Molecular Weight | 272.31 |
| CAS Registry Number | 919-38-0 |
| SMILES | C(O[P](SC(C(OC)=O)C)(=S)OCC)C |
| InChI | 1S/C8H17O4PS2/c1-5-11-13(14,12-6-2)15-7(3)8(9)10-4/h7H,5-6H2,1-4H3 |
| InChIKey | GFWIZHUAZXBTMF-UHFFFAOYSA-N |
| Density | 1.22g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.351°C at 760 mmHg (Cal.) |
| Flash point | 138.472°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phosphorodithioic acid S-[1-(methoxycarbonyl)ethyl] O,O-diethyl ester |