Online Database of Chemicals from Around the World
|
CAS#: 91953-88-7 Product: 9-(2-Methylpropyl)-6-(2-Methylpropylsulfanyl)Purin-2-Amine No suppilers available for the product. |
| Name | 9-(2-Methylpropyl)-6-(2-Methylpropylsulfanyl)Purin-2-Amine |
|---|---|
| Synonyms | 9-Isobutyl-6-Isobutylsulfanyl-Purin-2-Amine; 9-Isobutyl-6-(Isobutylthio)-2-Purinamine; [9-Isobutyl-6-(Isobutylthio)Purin-2-Yl]Amine |
| Molecular Structure |  |
| Molecular Formula | C13H21N5S |
| Molecular Weight | 279.40 |
| CAS Registry Number | 91953-88-7 |
| SMILES | C2=NC1=C(N=C(N=C1SCC(C)C)N)[N]2CC(C)C |
| InChI | 1S/C13H21N5S/c1-8(2)5-18-7-15-10-11(18)16-13(14)17-12(10)19-6-9(3)4/h7-9H,5-6H2,1-4H3,(H2,14,16,17) |
| InChIKey | TXJFULMMFWCUGZ-UHFFFAOYSA-N |
| Density | 1.284g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.97°C at 760 mmHg (Cal.) |
| Flash point | 248.916°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-(2-Methylpropyl)-6-(2-Methylpropylsulfanyl)Purin-2-Amine |