|
CAS#: 91969-56-1 Product: 4,6-Dimethylindan-5-Ol No suppilers available for the product. |
| Name | 4,6-Dimethylindan-5-Ol |
|---|---|
| Synonyms | 4,6-Dimethylindan-5-Ol; 4,6-Dimethyl-5-Indanol |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 |
| CAS Registry Number | 91969-56-1 |
| EINECS | 295-248-1 |
| SMILES | C1=C(C(=C(C2=C1CCC2)C)O)C |
| InChI | 1S/C11H14O/c1-7-6-9-4-3-5-10(9)8(2)11(7)12/h6,12H,3-5H2,1-2H3 |
| InChIKey | XWKMVRQWLRRRBO-UHFFFAOYSA-N |
| Density | 1.085g/cm3 (Cal.) |
|---|---|
| Boiling point | 280.477°C at 760 mmHg (Cal.) |
| Flash point | 126.111°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Dimethylindan-5-Ol |