|
CAS#: 92022-83-8 Product: N-(O-Aminophenyl)-5-Chloroanthranilic Acid No suppilers available for the product. |
| Name | N-(O-Aminophenyl)-5-Chloroanthranilic Acid |
|---|---|
| Synonyms | 2-[(2-Aminophenyl)Amino]-5-Chloro-Benzoic Acid; N-(O-Aminophenyl)-5-Chloroanthranilic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11ClN2O2 |
| Molecular Weight | 262.70 |
| CAS Registry Number | 92022-83-8 |
| EINECS | 295-357-4 |
| SMILES | C1=C(Cl)C=CC(=C1C(=O)O)NC2=C(N)C=CC=C2 |
| InChI | 1S/C13H11ClN2O2/c14-8-5-6-11(9(7-8)13(17)18)16-12-4-2-1-3-10(12)15/h1-7,16H,15H2,(H,17,18) |
| InChIKey | HESOTZPIFSCRFY-UHFFFAOYSA-N |
| Density | 1.441g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.398°C at 760 mmHg (Cal.) |
| Flash point | 215.307°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(O-Aminophenyl)-5-Chloroanthranilic Acid |