|
CAS#: 92297-66-0 Product: 2-Methoxy-6-(1-Methylethyl)Naphthalene No suppilers available for the product. |
| Name | 2-Methoxy-6-(1-Methylethyl)Naphthalene |
|---|---|
| Synonyms | 2-Isopropyl-6-Methoxy-Naphthalene; 2-Isopropyl-6-Methoxynaphthalene; 2-Methoxy-6-Propan-2-Yl-Naphthalene |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 |
| CAS Registry Number | 92297-66-0 |
| SMILES | C1=C(C(C)C)C=CC2=C1C=CC(=C2)OC |
| InChI | 1S/C14H16O/c1-10(2)11-4-5-13-9-14(15-3)7-6-12(13)8-11/h4-10H,1-3H3 |
| InChIKey | AAKRTZRMVMTCPV-UHFFFAOYSA-N |
| Density | 1.013g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.434°C at 760 mmHg (Cal.) |
| Flash point | 119.076°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methoxy-6-(1-Methylethyl)Naphthalene |