|
CAS#: 923-14-8 Product: Barium silver 2-(phosphonatooxy)acrylate No suppilers available for the product. |
| Name | Barium silver 2-(phosphonatooxy)acrylate |
|---|---|
| Synonyms | Barium; 2-Phosphonooxyacrylic Acid; Silver; Nsc91533 |
| Molecular Structure | ![]() |
| Molecular Formula | C3H5AgBaO6P |
| Molecular Weight | 413.25 |
| CAS Registry Number | 923-14-8 |
| EINECS | 213-089-8 |
| SMILES | [Ba].O=C(O)C(O[P](=O)(O)O)=C.[Ag] |
| InChI | 1S/C3H5O6P.Ag.Ba/c1-2(3(4)5)9-10(6,7)8;;/h1H2,(H,4,5)(H2,6,7,8);; |
| InChIKey | GFUAGYTVCSNBSV-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for Barium silver 2-(phosphonatooxy)acrylate |