Online Database of Chemicals from Around the World
|
CAS#: 92341-06-5 Product: 1,2,3,6,7,9-HexachloroDibenzofuran No suppilers available for the product. |
| Name | 1,2,3,6,7,9-HexachloroDibenzofuran |
|---|---|
| Synonyms | Dibenzofuran, 1,2,3,6,7,9-Hexachloro-; Dibenzofuran, 1,2,3,6,7,9-Hexachloro |
| Molecular Structure |  |
| Molecular Formula | C12H2Cl6O |
| Molecular Weight | 374.87 |
| CAS Registry Number | 92341-06-5 |
| SMILES | C3=C2OC1=C(C(=CC(=C1C2=C(C(=C3Cl)Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C12H2Cl6O/c13-3-1-4(14)10(17)12-7(3)8-6(19-12)2-5(15)9(16)11(8)18/h1-2H |
| InChIKey | JZVOLXQREJNTTL-UHFFFAOYSA-N |
| Density | 1.767g/cm3 (Cal.) |
|---|---|
| Boiling point | 474.262°C at 760 mmHg (Cal.) |
| Flash point | 240.625°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,6,7,9-HexachloroDibenzofuran |