|
CAS#: 92352-21-1 Product: Ethyl 7H-Purin-8-Ylsulfanylformate No suppilers available for the product. |
| Name | Ethyl 7H-Purin-8-Ylsulfanylformate |
|---|---|
| Synonyms | (7H-Purin-8-Ylthio)Formic Acid Ethyl Ester; Ethyl 7H-Purin-8-Ylsulfanylmethanoate; Nciopen2_003420 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8N4O2S |
| Molecular Weight | 224.24 |
| CAS Registry Number | 92352-21-1 |
| SMILES | C1=NC=NC2=C1[NH]C(=N2)SC(=O)OCC |
| InChI | 1S/C8H8N4O2S/c1-2-14-8(13)15-7-11-5-3-9-4-10-6(5)12-7/h3-4H,2H2,1H3,(H,9,10,11,12) |
| InChIKey | RQWFOULHPGOMPM-UHFFFAOYSA-N |
| Density | 1.504g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.755°C at 760 mmHg (Cal.) |
| Flash point | 208.87°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 7H-Purin-8-Ylsulfanylformate |