|
CAS#: 92369-26-1 Product: Ethyl 3-(2,6,6-Trimethylcyclohex-1-En-1-Yl)Acrylate No suppilers available for the product. |
| Name | Ethyl 3-(2,6,6-Trimethylcyclohex-1-En-1-Yl)Acrylate |
|---|---|
| Synonyms | (E)-3-(2,6,6-Trimethyl-1-Cyclohexenyl)Prop-2-Enoic Acid Ethyl Ester; (E)-3-(2,6,6-Trimethyl-1-Cyclohexenyl)Acrylic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 |
| CAS Registry Number | 92369-26-1 |
| EINECS | 296-230-6 |
| SMILES | C(OC(=O)/C=C/C1=C(CCCC1(C)C)C)C |
| InChI | 1S/C14H22O2/c1-5-16-13(15)9-8-12-11(2)7-6-10-14(12,3)4/h8-9H,5-7,10H2,1-4H3/b9-8+ |
| InChIKey | SGHXYRRAFDSHBV-CMDGGOBGSA-N |
| Density | 0.981g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.139°C at 760 mmHg (Cal.) |
| Flash point | 138.473°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-(2,6,6-Trimethylcyclohex-1-En-1-Yl)Acrylate |