|
CAS#: 923569-78-2 Product: (1Z)-N-[2-(Bromomethyl)-4-methoxyphenyl]-2,2,3,3,4,4,4-heptafluorobutanimidoyl chloride No suppilers available for the product. |
| Name | (1Z)-N-[2-(Bromomethyl)-4-methoxyphenyl]-2,2,3,3,4,4,4-heptafluorobutanimidoyl chloride |
|---|---|
| Synonyms | (1Z)-N-[2 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8BrClF7NO |
| Molecular Weight | 430.54 |
| CAS Registry Number | 923569-78-2 |
| SMILES | COc1ccc(c(c1)CBr)/N=C(/C(C(C(F)(F)F)(F)F)(F)F)\Cl |
| InChI | 1S/C12H8BrClF7NO/c1-23-7-2-3-8(6(4-7)5-13)22-9(14)10(15,16)11(17,18)12(19,20)21/h2-4H,5H2,1H3/b22-9- |
| InChIKey | ZSKDAYLWELBABO-AFPJDJCSSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 341.0±52.0°C at 760 mmHg (Cal.) |
| Flash point | 160.1±30.7°C (Cal.) |
| Refractive index | 1.457 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1Z)-N-[2-(Bromomethyl)-4-methoxyphenyl]-2,2,3,3,4,4,4-heptafluorobutanimidoyl chloride |