|
CAS#: 92398-22-6 Product: 4,5-Epoxy-3,6,14-Trihydroxy-6-(2-Carboxyallyl)-17-Methylmorphinan gamma-Lactone No suppilers available for the product. |
| Name | 4,5-Epoxy-3,6,14-Trihydroxy-6-(2-Carboxyallyl)-17-Methylmorphinan gamma-Lactone |
|---|---|
| Synonyms | 6-Dsmb-Oxymorphone |
| Molecular Structure | ![]() |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 |
| CAS Registry Number | 92398-22-6 |
| SMILES | [C@]134[C@H]5OC2=C1C(=CC=C2O)C[C@@H](N(CC3)C)[C@]4(O)CCC56OC(=O)C(C6)=C |
| InChI | 1S/C21H23NO5/c1-11-10-19(27-17(11)24)5-6-21(25)14-9-12-3-4-13(23)16-15(12)20(21,18(19)26-16)7-8-22(14)2/h3-4,14,18,23,25H,1,5-10H2,2H3/t14-,18+,19?,20+,21-/m1/s1 |
| InChIKey | MVSABGMEQVNJCP-MHEMIWTPSA-N |
| Density | 1.49g/cm3 (Cal.) |
|---|---|
| Boiling point | 617.375°C at 760 mmHg (Cal.) |
| Flash point | 327.177°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Epoxy-3,6,14-Trihydroxy-6-(2-Carboxyallyl)-17-Methylmorphinan gamma-Lactone |