|
CAS#: 92474-94-7 Product: 3,8,10-Trimethyl-3,5,8,10-Tetrazabicyclo[4.4.0]Deca-4,11-Diene-2,7,9-Trione No suppilers available for the product. |
| Name | 3,8,10-Trimethyl-3,5,8,10-Tetrazabicyclo[4.4.0]Deca-4,11-Diene-2,7,9-Trione |
|---|---|
| Synonyms | Nsc515721 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10N4O3 |
| Molecular Weight | 222.20 |
| CAS Registry Number | 92474-94-7 |
| SMILES | CN1C(=O)N(C2=C(C1=O)N=CN(C2=O)C)C |
| InChI | 1S/C9H10N4O3/c1-11-4-10-5-6(8(11)15)12(2)9(16)13(3)7(5)14/h4H,1-3H3 |
| InChIKey | SYYPSBXVMCETKL-UHFFFAOYSA-N |
| Density | 1.513g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.288°C at 760 mmHg (Cal.) |
| Flash point | 146.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,8,10-Trimethyl-3,5,8,10-Tetrazabicyclo[4.4.0]Deca-4,11-Diene-2,7,9-Trione |