|
CAS#: 92494-53-6 Product: 6-[(2-Chlorophenyl)Methylsulfanyl]-9-Propyl-Purin-2-Amine No suppilers available for the product. |
| Name | 6-[(2-Chlorophenyl)Methylsulfanyl]-9-Propyl-Purin-2-Amine |
|---|---|
| Synonyms | 6-[(2-Chlorophenyl)Methylsulfanyl]-9-Propyl-Purin-2-Amine; 6-[(2-Chlorophenyl)Methylthio]-9-Propyl-2-Purinamine; [6-[(2-Chlorobenzyl)Thio]-9-Propyl-Purin-2-Yl]Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16ClN5S |
| Molecular Weight | 333.84 |
| CAS Registry Number | 92494-53-6 |
| SMILES | C2=NC1=C(N=C(N=C1[N]2CCC)N)SCC3=C(C=CC=C3)Cl |
| InChI | 1S/C15H16ClN5S/c1-2-7-21-9-18-12-13(21)19-15(17)20-14(12)22-8-10-5-3-4-6-11(10)16/h3-6,9H,2,7-8H2,1H3,(H2,17,19,20) |
| InChIKey | ZITJURWWDLKJNF-UHFFFAOYSA-N |
| Density | 1.431g/cm3 (Cal.) |
|---|---|
| Boiling point | 578.398°C at 760 mmHg (Cal.) |
| Flash point | 303.604°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-[(2-Chlorophenyl)Methylsulfanyl]-9-Propyl-Purin-2-Amine |