|
CAS#: 92522-90-2 Product: Fupiram No suppilers available for the product. |
| Name | Fupiram |
|---|---|
| Synonyms | 4-Chloro-2-(2-Furylmethylamino)-5-Sulfamoyl-Benzoic Acid; 3,5-Diamino-6-Chloro-N-(Diaminomethylene)Pyrazine-2-Carboxamide; 4-Chloro-2-(2-Furylmethylamino)-5-Sulfamoylbenzoic Acid; 3,5-Diamino-6-Chloro-N-(Diaminomethylene)-2-Pyrazinecarboxamide; 4-Chloro-2-( |
| Molecular Structure | ![]() |
| Molecular Formula | C18H19Cl2N9O6S |
| Molecular Weight | 560.37 |
| CAS Registry Number | 92522-90-2 |
| SMILES | C1=C(C(=CC(=C1[S](=O)(=O)N)Cl)NCC2=CC=CO2)C(O)=O.C3(=C(N=C(N)C(=N3)Cl)N)C(=O)N=C(N)N |
| InChI | 1S/C12H11ClN2O5S.C6H8ClN7O/c13-9-5-10(15-6-7-2-1-3-20-7)8(12(16)17)4-11(9)21(14,18)19;7-2-4(9)13-3(8)1(12-2)5(15)14-6(10)11/h1-5,15H,6H2,(H,16,17)(H2,14,18,19);(H4,8,9,13)(H4,10,11,14,15) |
| InChIKey | ATRWXXOQLDHYLB-UHFFFAOYSA-N |
| Boiling point | 582.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 305.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Fupiram |