|
CAS#: 92642-58-5 Product: 1-Deoxygluco-Heptulose 2-Phosphate No suppilers available for the product. |
| Name | 1-Deoxygluco-Heptulose 2-Phosphate |
|---|---|
| Synonyms | [(2R,3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(Hydroxymethyl)-2-Methyl-Tetrahydropyran-2-Yl] Dihydrogen Phosphate; [(2R,3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(Hydroxymethyl)-2-Methyl-2-Tetrahydropyranyl] Dihydrogen Phosphate; [(2R,3R,4S,5S,6R)-3,4,5-Trihydroxy-2-Methyl-6- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H15O9P |
| Molecular Weight | 274.16 |
| CAS Registry Number | 92642-58-5 |
| SMILES | [C@H]1([C@H]([C@@H]([C@H](O[C@@]1(O[P](O)(=O)O)C)CO)O)O)O |
| InChI | 1S/C7H15O9P/c1-7(16-17(12,13)14)6(11)5(10)4(9)3(2-8)15-7/h3-6,8-11H,2H2,1H3,(H2,12,13,14)/t3-,4-,5+,6-,7-/m1/s1 |
| InChIKey | QZBAZODTRUGOQS-XUUWZHRGSA-N |
| Density | 1.797g/cm3 (Cal.) |
|---|---|
| Boiling point | 572.379°C at 760 mmHg (Cal.) |
| Flash point | 299.964°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Deoxygluco-Heptulose 2-Phosphate |