|
CAS#: 92782-48-4 Product: 4-Methyl-N-EthylPyrrolo[3,2-g]Coumarin No suppilers available for the product. |
| Name | 4-Methyl-N-EthylPyrrolo[3,2-g]Coumarin |
|---|---|
| Synonyms | 8-Ethyl-4-Methyl-Pyrano[5,6-F]Indol-2-One; 8-Ethyl-4-Methyl-2-Pyrano[5,6-F]Indolone; 4-Mepc |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 |
| CAS Registry Number | 92782-48-4 |
| SMILES | C1=C3C(=CC2=C1C(=CC(O2)=O)C)[N](C=C3)CC |
| InChI | 1S/C14H13NO2/c1-3-15-5-4-10-7-11-9(2)6-14(16)17-13(11)8-12(10)15/h4-8H,3H2,1-2H3 |
| InChIKey | JQYCSXQTVLUHSQ-UHFFFAOYSA-N |
| Density | 1.227g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.403°C at 760 mmHg (Cal.) |
| Flash point | 212.286°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-N-EthylPyrrolo[3,2-g]Coumarin |