|
CAS#: 928713-37-5 Product: 3-Amino-3-[2-(3,4-dichlorophenyl)-5-pyrimidinyl]propanoic acid No suppilers available for the product. |
| Name | 3-Amino-3-[2-(3,4-dichlorophenyl)-5-pyrimidinyl]propanoic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H11Cl2N3O2 |
| Molecular Weight | 312.15 |
| CAS Registry Number | 928713-37-5 |
| SMILES | c1cc(c(cc1c2ncc(cn2)C(CC(=O)O)N)Cl)Cl |
| InChI | 1S/C13H11Cl2N3O2/c14-9-2-1-7(3-10(9)15)13-17-5-8(6-18-13)11(16)4-12(19)20/h1-3,5-6,11H,4,16H2,(H,19,20) |
| InChIKey | YMQYQYNJEIYSCC-UHFFFAOYSA-N |
| Density | 1.462g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.969°C at 760 mmHg (Cal.) |
| Flash point | 212.628°C (Cal.) |
| Refractive index | 1.632 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-3-[2-(3,4-dichlorophenyl)-5-pyrimidinyl]propanoic acid |