|
CAS#: 93413-05-9 Product: Asperlicin E No suppilers available for the product. |
| Name | Asperlicin E |
|---|---|
| Synonyms | Asperlicin E |
| Molecular Structure | ![]() |
| Molecular Formula | C25H18N4O3 |
| Molecular Weight | 422.44 |
| CAS Registry Number | 93413-05-9 |
| SMILES | [C@@H]12N6[C@@H](C[C@]1(O)C3=C(N2)C=CC=C3)C5=NC4=CC=CC=C4C(=O)N5C7=C(C6=O)C=CC=C7 |
| InChI | 1S/C25H18N4O3/c30-22-14-7-1-4-10-17(14)26-21-20-13-25(32)16-9-3-5-11-18(16)27-24(25)29(20)23(31)15-8-2-6-12-19(15)28(21)22/h1-12,20,24,27,32H,13H2/t20-,24+,25-/m0/s1 |
| InChIKey | HYHLSEUXMRFVND-AMDXRBSFSA-N |
| Density | 1.604g/cm3 (Cal.) |
|---|---|
| Boiling point | 726.86°C at 760 mmHg (Cal.) |
| Flash point | 393.391°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Asperlicin E |