|
CAS#: 93565-45-8 Product: 1,3-Dichloro-6,7-Dihydro-5H-Dibenz[b,g][1,4]Oxazocine Hydrochloride No suppilers available for the product. |
| Name | 1,3-Dichloro-6,7-Dihydro-5H-Dibenz[b,g][1,4]Oxazocine Hydrochloride |
|---|---|
| Synonyms | 1,3-Dichloro-6,7-Dihydro-5H-Dibenz(B,G)(1,4)Oxazocine Hydrochloride; 1,3-Dichloro-6,7-Dihydro-5H-Dibenz(B,G)-1,4-Oxazocine; 5H-Dibenz(B,G)(1,4)Oxazocine, 1,3-Dichloro-6,7-Dihydro-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12Cl3NO |
| Molecular Weight | 316.61 |
| CAS Registry Number | 93565-45-8 |
| SMILES | [H+].C3=C2NCCC1=CC=CC=C1OC2=C(Cl)C=C3Cl.[Cl-] |
| InChI | 1S/C14H11Cl2NO.ClH/c15-10-7-11(16)14-12(8-10)17-6-5-9-3-1-2-4-13(9)18-14;/h1-4,7-8,17H,5-6H2;1H |
| InChIKey | ASPZQIMIAWIQNZ-UHFFFAOYSA-N |
| Boiling point | 430.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 214.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dichloro-6,7-Dihydro-5H-Dibenz[b,g][1,4]Oxazocine Hydrochloride |