|
CAS#: 93570-95-7 Product: 2-(4-Butan-2-Yl-3-Methyl-Phenoxy)Propanoic Acid No suppilers available for the product. |
| Name | 2-(4-Butan-2-Yl-3-Methyl-Phenoxy)Propanoic Acid |
|---|---|
| Synonyms | 2-(3-Methyl-4-Sec-Butyl-Phenoxy)Propanoic Acid; 2-(3-Methyl-4-Sec-Butylphenoxy)Propanoic Acid; 2-(3-Methyl-4-Sec-Butyl-Phenoxy)Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 |
| CAS Registry Number | 93570-95-7 |
| SMILES | C1=C(OC(C(=O)O)C)C=CC(=C1C)C(C)CC |
| InChI | 1S/C14H20O3/c1-5-9(2)13-7-6-12(8-10(13)3)17-11(4)14(15)16/h6-9,11H,5H2,1-4H3,(H,15,16) |
| InChIKey | DCIIVVHKTKERNJ-UHFFFAOYSA-N |
| Density | 1.054g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.702°C at 760 mmHg (Cal.) |
| Flash point | 129.273°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Butan-2-Yl-3-Methyl-Phenoxy)Propanoic Acid |