|
CAS#: 93762-17-5 Product: N,N,2,2,4-Pentamethylvaleramide No suppilers available for the product. |
| Name | N,N,2,2,4-Pentamethylvaleramide |
|---|---|
| Synonyms | N,N,2,2,4-Pentamethylvaleramide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 |
| CAS Registry Number | 93762-17-5 |
| EINECS | 297-731-2 |
| SMILES | C(C(C(=O)N(C)C)(C)C)C(C)C |
| InChI | 1S/C10H21NO/c1-8(2)7-10(3,4)9(12)11(5)6/h8H,7H2,1-6H3 |
| InChIKey | DDOZFENEPXDBJR-UHFFFAOYSA-N |
| Density | 0.863g/cm3 (Cal.) |
|---|---|
| Boiling point | 215.882°C at 760 mmHg (Cal.) |
| Flash point | 76.426°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N,2,2,4-Pentamethylvaleramide |