|
CAS#: 93777-00-5 Product: 1-(3,4-Dihydroxyphenyl)-2-(Ethylamino)Propan-1-One No suppilers available for the product. |
| Name | 1-(3,4-Dihydroxyphenyl)-2-(Ethylamino)Propan-1-One |
|---|---|
| Synonyms | 1-(3,4-Dihydroxyphenyl)-2-Ethylamino-Propan-1-One; 1-(3,4-Dihydroxyphenyl)-2-(Ethylamino)Propan-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 |
| CAS Registry Number | 93777-00-5 |
| EINECS | 298-027-8 |
| SMILES | C1=C(C(=O)C(NCC)C)C=CC(=C1O)O |
| InChI | 1S/C11H15NO3/c1-3-12-7(2)11(15)8-4-5-9(13)10(14)6-8/h4-7,12-14H,3H2,1-2H3 |
| InChIKey | MMTPCMCJFNWHLO-UHFFFAOYSA-N |
| Density | 1.185g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.694°C at 760 mmHg (Cal.) |
| Flash point | 201.576°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3,4-Dihydroxyphenyl)-2-(Ethylamino)Propan-1-One |