|
CAS#: 93777-87-8 Product: N,N-Dimethyl-N'-(2-Methylphenyl)Acetamidine No suppilers available for the product. |
| Name | N,N-Dimethyl-N'-(2-Methylphenyl)Acetamidine |
|---|---|
| Synonyms | N,N-Dimethyl-N'-(2-Methylphenyl)Acetamidine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 |
| CAS Registry Number | 93777-87-8 |
| EINECS | 298-118-2 |
| SMILES | C1=CC=CC(=C1N=C(N(C)C)C)C |
| InChI | 1S/C11H16N2/c1-9-7-5-6-8-11(9)12-10(2)13(3)4/h5-8H,1-4H3 |
| InChIKey | UENINLIJIFKGHL-UHFFFAOYSA-N |
| Density | 0.913g/cm3 (Cal.) |
|---|---|
| Boiling point | 263.492°C at 760 mmHg (Cal.) |
| Flash point | 113.156°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-N'-(2-Methylphenyl)Acetamidine |