|
CAS#: 93778-36-0 Product: N5-(Diaminomethylene)-L-ornithine (2Z)-2-butenedioate (1:1) No suppilers available for the product. |
| Name | N5-(Diaminomethylene)-L-ornithine (2Z)-2-butenedioate (1:1) |
|---|---|
| Synonyms | L-arginine maleate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18N4O6 |
| Molecular Weight | 290.27 |
| CAS Registry Number | 93778-36-0 |
| EINECS | 298-172-7 |
| SMILES | O=C(O)\C=C/C(=O)O.O=C(O)[C@@H](N)CCC/N=C(\N)N |
| InChI | 1S/C6H14N4O2.C4H4O4/c7-4(5(11)12)2-1-3-10-6(8)9;5-3(6)1-2-4(7)8/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1-2H,(H,5,6)(H,7,8)/b;2-1-/t4-;/m0./s1 |
| InChIKey | VNFMIHBKZKZIQO-HSBCLPKZSA-N |
| Boiling point | 409.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 201.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N5-(Diaminomethylene)-L-ornithine (2Z)-2-butenedioate (1:1) |