|
CAS#: 93803-24-8 Product: 2-Oxo-3-phenylpropanoic acid - L-histidine (1:1) No suppilers available for the product. |
| Name | 2-Oxo-3-phenylpropanoic acid - L-histidine (1:1) |
|---|---|
| Synonyms | L-histidine mono(3-phenylpyruvate) |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.31 |
| CAS Registry Number | 93803-24-8 |
| EINECS | 298-294-0 |
| SMILES | N[C@@H](Cc1cncn1)C(O)=O.OC(=O)C(=O)Cc1ccccc1 |
| InChI | 1S/C9H8O3.C6H9N3O2/c10-8(9(11)12)6-7-4-2-1-3-5-7;7-5(6(10)11)1-4-2-8-3-9-4/h1-5H,6H2,(H,11,12);2-3,5H,1,7H2,(H,8,9)(H,10,11)/t;5-/m.0/s1 |
| InChIKey | HXWWOVBNGFGPHI-ZSCHJXSPSA-N |
| Boiling point | 634.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 337.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Oxo-3-phenylpropanoic acid - L-histidine (1:1) |