|
CAS#: 93803-57-7 Product: 2,2'-Methylenebis(6-cyclooctyl-4-isopropylphenol) No suppilers available for the product. |
| Name | 2,2'-Methylenebis(6-cyclooctyl-4-isopropylphenol) |
|---|---|
| Synonyms | 2,2'-methylenebis[6-cyclooctyl-4-isopropylphenol] |
| Molecular Structure | ![]() |
| Molecular Formula | C35H52O2 |
| Molecular Weight | 504.79 |
| CAS Registry Number | 93803-57-7 |
| EINECS | 298-328-4 |
| SMILES | CC(C)c3cc(Cc1cc(cc(c1O)C2CCCCCCC2)C(C)C)c(O)c(c3)C4CCCCCCC4 |
| InChI | 1S/C35H52O2/c1-24(2)28-19-30(34(36)32(22-28)26-15-11-7-5-8-12-16-26)21-31-20-29(25(3)4)23-33(35(31)37)27-17-13-9-6-10-14-18-27/h19-20,22-27,36-37H,5-18,21H2,1-4H3 |
| InChIKey | LLEGIWXOFYVFCM-UHFFFAOYSA-N |
| Density | 1.011g/cm3 (Cal.) |
|---|---|
| Boiling point | 557.419°C at 760 mmHg (Cal.) |
| Flash point | 214.814°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-Methylenebis(6-cyclooctyl-4-isopropylphenol) |