|
CAS#: 93839-01-1 Product: 4,5-Dichloro-2-Methylanilinium Chloride No suppilers available for the product. |
| Name | 4,5-Dichloro-2-Methylanilinium Chloride |
|---|---|
| Synonyms | (4,5-Dichloro-2-Methyl-Phenyl)Ammonium Chloride; (4,5-Dichloro-2-Methylphenyl)Ammonium Chloride; (4,5-Dichloro-2-Methyl-Phenyl)Azanium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C7H8Cl3N |
| Molecular Weight | 212.51 |
| CAS Registry Number | 93839-01-1 |
| EINECS | 298-772-9 |
| SMILES | C1=C(Cl)C(=CC(=C1[NH3+])C)Cl.[Cl-] |
| InChI | 1S/C7H7Cl2N.ClH/c1-4-2-5(8)6(9)3-7(4)10;/h2-3H,10H2,1H3;1H |
| InChIKey | DUJWHJDGPAUZFV-UHFFFAOYSA-N |
| Boiling point | 289.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 128.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dichloro-2-Methylanilinium Chloride |