|
CAS#: 93839-13-5 Product: 4-(4-Chlorophenyl)-4-Hydroxypiperidin-2-One No suppilers available for the product. |
| Name | 4-(4-Chlorophenyl)-4-Hydroxypiperidin-2-One |
|---|---|
| Synonyms | 4-(4-Chlorophenyl)-4-Hydroxy-Piperidin-2-One; 4-(4-Chlorophenyl)-4-Hydroxy-2-Piperidinone; 4-(4-Chlorophenyl)-4-Hydroxy-2-Piperidone |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67 |
| CAS Registry Number | 93839-13-5 |
| EINECS | 298-782-3 |
| SMILES | C1=C(Cl)C=CC(=C1)C2(O)CC(=O)NCC2 |
| InChI | 1S/C11H12ClNO2/c12-9-3-1-8(2-4-9)11(15)5-6-13-10(14)7-11/h1-4,15H,5-7H2,(H,13,14) |
| InChIKey | FOZDUEGEXJAZGP-UHFFFAOYSA-N |
| Density | 1.323g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.674°C at 760 mmHg (Cal.) |
| Flash point | 230.593°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Chlorophenyl)-4-Hydroxypiperidin-2-One |