|
CAS#: 93839-69-1 Product: 2-Chloro-N-Methyl-6-Nitrobenzylamine Monohydrochloride No suppilers available for the product. |
| Name | 2-Chloro-N-Methyl-6-Nitrobenzylamine Monohydrochloride |
|---|---|
| Synonyms | N-[(2-Chloro-6-Nitro-Phenyl)Methyl]Methanamine Hydrochloride; (2-Chloro-6-Nitro-Benzyl)-Methyl-Amine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10Cl2N2O2 |
| Molecular Weight | 237.09 |
| CAS Registry Number | 93839-69-1 |
| EINECS | 298-840-8 |
| SMILES | [H+].C1=CC=C(Cl)C(=C1[N+]([O-])=O)CNC.[Cl-] |
| InChI | 1S/C8H9ClN2O2.ClH/c1-10-5-6-7(9)3-2-4-8(6)11(12)13;/h2-4,10H,5H2,1H3;1H |
| InChIKey | IVCUINMPRWYMNQ-UHFFFAOYSA-N |
| Boiling point | 273.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 119.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-N-Methyl-6-Nitrobenzylamine Monohydrochloride |