|
CAS#: 93840-91-6 Product: 5-Methoxy-2-(2-Methyl-1-Propenyl)Phenol No suppilers available for the product. |
| Name | 5-Methoxy-2-(2-Methyl-1-Propenyl)Phenol |
|---|---|
| Synonyms | 5-Methoxy-2-(2-Methyl-1-Propenyl)Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 |
| CAS Registry Number | 93840-91-6 |
| EINECS | 298-959-5 |
| SMILES | C1=C(OC)C=CC(=C1O)C=C(C)C |
| InChI | 1S/C11H14O2/c1-8(2)6-9-4-5-10(13-3)7-11(9)12/h4-7,12H,1-3H3 |
| InChIKey | KUFHEKHXFPHIIQ-UHFFFAOYSA-N |
| Density | 1.054g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.583°C at 760 mmHg (Cal.) |
| Flash point | 161.109°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methoxy-2-(2-Methyl-1-Propenyl)Phenol |