|
CAS#: 93841-11-3 Product: 3-[[Imino(Methylphenylamino)Methyl]Thio]Propanesulphonic Acid No suppilers available for the product. |
| Name | 3-[[Imino(Methylphenylamino)Methyl]Thio]Propanesulphonic Acid |
|---|---|
| Synonyms | 3-[[Amino-(2-Methylphenyl)Iminomethyl]Thio]Propane-1-Sulfonic Acid; 3-[[N'-(2-Methylphenyl)Carbamimidoyl]Thio]Propane-1-Sulfonic Acid; 3-((Imino(Methylphenylamino)Methyl)Thio)Propanesulphonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16N2O3S2 |
| Molecular Weight | 288.38 |
| CAS Registry Number | 93841-11-3 |
| EINECS | 298-981-5 |
| SMILES | C1=CC=CC(=C1N=C(SCCC[S](=O)(=O)O)N)C |
| InChI | 1S/C11H16N2O3S2/c1-9-5-2-3-6-10(9)13-11(12)17-7-4-8-18(14,15)16/h2-3,5-6H,4,7-8H2,1H3,(H2,12,13)(H,14,15,16) |
| InChIKey | IPBDARPBQYGOBG-UHFFFAOYSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-[[Imino(Methylphenylamino)Methyl]Thio]Propanesulphonic Acid |