|
CAS#: 93841-21-5 Product: 3-methyl-4-morpholin-4-ium-4-yl-2,2-diphenyl-butanoic acid sulfate No suppilers available for the product. |
| Name | 3-methyl-4-morpholin-4-ium-4-yl-2,2-diphenyl-butanoic acid sulfate |
|---|---|
| Synonyms | 4-(3-carb |
| Molecular Structure | ![]() |
| Molecular Formula | C21H26NO7S |
| Molecular Weight | 436.50 |
| CAS Registry Number | 93841-21-5 |
| EINECS | 298-992-5 |
| SMILES | CC(C[NH+]1CCOCC1)C(c2ccccc2)(c3ccccc3)C(O)=O.[O-]S([O-])(=O)=O |
| InChI | 1S/C21H25NO3.H2O4S/c1-17(16-22-12-14-25-15-13-22)21(20(23)24,18-8-4-2-5-9-18)19-10-6-3-7-11-19;1-5(2,3)4/h2-11,17H,12-16H2,1H3,(H,23,24);(H2,1,2,3,4)/p-1 |
| InChIKey | OFIQJTJIXKPUGI-UHFFFAOYSA-M |
| Boiling point | 586.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 308.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-methyl-4-morpholin-4-ium-4-yl-2,2-diphenyl-butanoic acid sulfate |