|
CAS#: 93846-72-1 Product: 1,1-Dioxo-3-Phenyl-1,3-Thiazinane-2,4-Dione No suppilers available for the product. |
| Name | 1,1-Dioxo-3-Phenyl-1,3-Thiazinane-2,4-Dione |
|---|---|
| Synonyms | 1,1-Diketo-3-Phenyl-1,3-Thiazinane-2,4-Quinone; Nsc319071 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO4S |
| Molecular Weight | 239.25 |
| CAS Registry Number | 93846-72-1 |
| SMILES | C2=C(N1C(CC[S](=O)(=O)C1=O)=O)C=CC=C2 |
| InChI | 1S/C10H9NO4S/c12-9-6-7-16(14,15)10(13)11(9)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | RCQVTEZQQDYHIQ-UHFFFAOYSA-N |
| Density | 1.484g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.954°C at 760 mmHg (Cal.) |
| Flash point | 199.919°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1-Dioxo-3-Phenyl-1,3-Thiazinane-2,4-Dione |