|
CAS#: 93856-92-9 Product: 3-Allyl-1-[2-Hydroxy-1-(Hydroxymethyl)-2-(4-Nitrophenyl)Ethyl]Thiourea No suppilers available for the product. |
| Name | 3-Allyl-1-[2-Hydroxy-1-(Hydroxymethyl)-2-(4-Nitrophenyl)Ethyl]Thiourea |
|---|---|
| Synonyms | 3-Allyl-1-[2-Hydroxy-1-(Hydroxymethyl)-2-(4-Nitrophenyl)Ethyl]Thiourea; 3-Allyl-1-[2-Hydroxy-1-Methylol-2-(4-Nitrophenyl)Ethyl]Thiourea; 1-[1,3-Dihydroxy-1-(4-Nitrophenyl)Propan-2-Yl]-3-Prop-2-Enyl-Thiourea |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 |
| CAS Registry Number | 93856-92-9 |
| EINECS | 299-126-9 |
| SMILES | C1=C(C(O)C(NC(=S)NCC=C)CO)C=CC(=C1)[N+]([O-])=O |
| InChI | 1S/C13H17N3O4S/c1-2-7-14-13(21)15-11(8-17)12(18)9-3-5-10(6-4-9)16(19)20/h2-6,11-12,17-18H,1,7-8H2,(H2,14,15,21) |
| InChIKey | TWJSRGVAULVARB-UHFFFAOYSA-N |
| Density | 1.351g/cm3 (Cal.) |
|---|---|
| Boiling point | 516.635°C at 760 mmHg (Cal.) |
| Flash point | 266.252°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Allyl-1-[2-Hydroxy-1-(Hydroxymethyl)-2-(4-Nitrophenyl)Ethyl]Thiourea |