Online Database of Chemicals from Around the World
|
CAS#: 93857-53-5 Product: Bis[PerfluorotetradecylEthyl] Hydrogen Phosphate No suppilers available for the product. |
| Name | Bis[PerfluorotetradecylEthyl] Hydrogen Phosphate |
|---|---|
| Molecular Structure | ![CAS#: 93857-53-5, Bis[PerfluorotetradecylEthyl] Hydrogen Phosphate](/moreStructures/93857-53-5.gif) |
| Molecular Formula | C32H9F58O4P |
| Molecular Weight | 1590.30 |
| CAS Registry Number | 93857-53-5 |
| EINECS | 299-188-7 |
| SMILES | C(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CO[P](OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(O)=O |
| InChI | 1S/C32H9F58O4P/c33-5(34,7(37,38)9(41,42)11(45,46)13(49,50)15(53,54)17(57,58)19(61,62)21(65,66)23(69,70)25(73,74)27(77,78)29(81,82)31(85,86)87)1-3-93-95(91,92)94-4-2-6(35,36)8(39,40)10(43,44)12(47,48)14(51,52)16(55,56)18(59,60)20(63,64)22(67,68)24(71,72)26 |
| InChIKey | VAPDLYGIEFOUOV-UHFFFAOYSA-N |
| Density | 1.751g/cm3 (Cal.) |
|---|---|
| Boiling point | 530.835°C at 760 mmHg (Cal.) |
| Flash point | 274.84°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis[PerfluorotetradecylEthyl] Hydrogen Phosphate |