|
CAS#: 93857-45-5 Product: Diammonium 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl phosphate No suppilers available for the product. |
| Name | Diammonium 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl phosphate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H12F21N2O4P |
| Molecular Weight | 678.17 |
| CAS Registry Number | 93857-45-5 |
| EINECS | 299-179-8 |
| SMILES | [NH4+].[NH4+].[O-]P([O-])(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | 1S/C12H6F21O4P.2H3N/c13-3(14,1-2-37-38(34,35)36)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)9(25,26)10(27,28)11(29,30)12(31,32)33;;/h1-2H2,(H2,34,35,36);2*1H3 |
| InChIKey | FSJLLRNJLNPGBZ-UHFFFAOYSA-N |
| Boiling point | 411.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 202.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diammonium 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl phosphate |