|
CAS#: 93857-94-4 Product: 2-Phenylpropyl 2-Butenoate No suppilers available for the product. |
| Name | 2-Phenylpropyl 2-Butenoate |
|---|---|
| Synonyms | (E)-But-2-Enoic Acid 2-Phenylpropyl Ester; 2-Phenylpropyl 2-Butenoate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 |
| CAS Registry Number | 93857-94-4 |
| EINECS | 299-228-3 |
| SMILES | C1=C(C(COC(=O)\C=C\C)C)C=CC=C1 |
| InChI | 1S/C13H16O2/c1-3-7-13(14)15-10-11(2)12-8-5-4-6-9-12/h3-9,11H,10H2,1-2H3/b7-3+ |
| InChIKey | LQWSYJWVIVLBFG-XVNBXDOJSA-N |
| Density | 1.008g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.878°C at 760 mmHg (Cal.) |
| Flash point | 156.308°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenylpropyl 2-Butenoate |