|
CAS#: 93858-04-9 Product: 2-[[4-[[2-Chloro-4-(Methylsulphonyl)Phenyl]Azo]Phenyl]Ethylamino]Ethanol No suppilers available for the product. |
| Name | 2-[[4-[[2-Chloro-4-(Methylsulphonyl)Phenyl]Azo]Phenyl]Ethylamino]Ethanol |
|---|---|
| Synonyms | 2-[1-[4-(2-Chloro-4-Methylsulfonyl-Phenyl)Azophenyl]Ethylamino]Ethanol; 2-[1-[4-(2-Chloro-4-Methylsulfonylphenyl)Azophenyl]Ethylamino]Ethanol; 2-[1-[4-(2-Chloro-4-Mesyl-Phenyl)Azophenyl]Ethylamino]Ethanol |
| Molecular Structure | ![]() |
| Molecular Formula | C17H20ClN3O3S |
| Molecular Weight | 381.88 |
| CAS Registry Number | 93858-04-9 |
| EINECS | 299-239-3 |
| SMILES | C1=C([S](=O)(=O)C)C=CC(=C1Cl)N=NC2=CC=C(C(NCCO)C)C=C2 |
| InChI | 1S/C17H20ClN3O3S/c1-12(19-9-10-22)13-3-5-14(6-4-13)20-21-17-8-7-15(11-16(17)18)25(2,23)24/h3-8,11-12,19,22H,9-10H2,1-2H3 |
| InChIKey | LSCRWPFZJSGWHE-UHFFFAOYSA-N |
| Density | 1.324g/cm3 (Cal.) |
|---|---|
| Boiling point | 604.787°C at 760 mmHg (Cal.) |
| Flash point | 319.564°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[[4-[[2-Chloro-4-(Methylsulphonyl)Phenyl]Azo]Phenyl]Ethylamino]Ethanol |