|
CAS#: 93858-64-1 Product: Inosine 5'-(Tetrahydrogen Triphosphate), 2',3'-Dideoxy-, Trilithium Salt No suppilers available for the product. |
| Name | Inosine 5'-(Tetrahydrogen Triphosphate), 2',3'-Dideoxy-, Trilithium Salt |
|---|---|
| Synonyms | (Hydroxy-Phosphonooxy-Phosphoryl) [(2S,5R)-5-(6-Oxo-3H-Purin-9-Yl)Tetrahydrofuran-2-Yl]Methyl Hydrogen Phosphate; (Hydroxy-Phosphonooxyphosphoryl) [(2S,5R)-5-(6-Oxo-3H-Purin-9-Yl)-2-Tetrahydrofuranyl]Methyl Hydrogen Phosphate; (Hydroxy-Phosphonooxy-Phosphor |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15N4O12P3 |
| Molecular Weight | 476.17 |
| CAS Registry Number | 93858-64-1 (122406-02-4) |
| EINECS | 299-296-4 |
| SMILES | [C@H]1(O[C@@H](CC1)CO[P](O[P](O[P](O)(O)=O)(O)=O)(O)=O)[N]2C3=C(N=C2)C(=O)N=CN3 |
| InChI | 1S/C10H15N4O12P3/c15-10-8-9(11-4-12-10)14(5-13-8)7-2-1-6(24-7)3-23-28(19,20)26-29(21,22)25-27(16,17)18/h4-7H,1-3H2,(H,19,20)(H,21,22)(H,11,12,15)(H2,16,17,18)/t6-,7+/m0/s1 |
| InChIKey | ZXZIQGYRHQJWSY-NKWVEPMBSA-N |
| Density | 2.4g/cm3 (Cal.) |
|---|---|
| Boiling point | 882.672°C at 760 mmHg (Cal.) |
| Flash point | 487.623°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Inosine 5'-(Tetrahydrogen Triphosphate), 2',3'-Dideoxy-, Trilithium Salt |