|
CAS#: 93859-21-3 Product: 2,2'-{Sulfonylbis[(2-chloro-4,1-phenylene)oxy]}diethanol No suppilers available for the product. |
| Name | 2,2'-{Sulfonylbis[(2-chloro-4,1-phenylene)oxy]}diethanol |
|---|---|
| Synonyms | 2,2'-[sulphonylbis[(2-chloro-4,1-phenylene)oxy]]bisethanol |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16Cl2O6S |
| Molecular Weight | 407.27 |
| CAS Registry Number | 93859-21-3 |
| EINECS | 299-358-0 |
| SMILES | Clc1cc(ccc1OCCO)S(=O)(=O)c2ccc(OCCO)c(Cl)c2 |
| InChI | 1S/C16H16Cl2O6S/c17-13-9-11(1-3-15(13)23-7-5-19)25(21,22)12-2-4-16(14(18)10-12)24-8-6-20/h1-4,9-10,19-20H,5-8H2 |
| InChIKey | XNJRPAPQYLXGPR-UHFFFAOYSA-N |
| Density | 1.466g/cm3 (Cal.) |
|---|---|
| Boiling point | 633.632°C at 760 mmHg (Cal.) |
| Flash point | 337.009°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-{Sulfonylbis[(2-chloro-4,1-phenylene)oxy]}diethanol |