|
CAS#: 93892-32-1 Product: 4,6-Dichloro-1,1,3,3-Tetramethylindan-5-Ol No suppilers available for the product. |
| Name | 4,6-Dichloro-1,1,3,3-Tetramethylindan-5-Ol |
|---|---|
| Synonyms | 4,6-Dichloro-1,1,3,3-Tetramethyl-Indan-5-Ol; 4,6-Dichloro-1,1,3,3-Tetramethyl-5-Indanol; 4,6-Dichloro-1,1,3,3-Tetramethylindan-5-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16Cl2O |
| Molecular Weight | 259.17 |
| CAS Registry Number | 93892-32-1 |
| EINECS | 299-514-8 |
| SMILES | C1=C(Cl)C(=C(Cl)C2=C1C(CC2(C)C)(C)C)O |
| InChI | 1S/C13H16Cl2O/c1-12(2)6-13(3,4)9-7(12)5-8(14)11(16)10(9)15/h5,16H,6H2,1-4H3 |
| InChIKey | FTHYZVZUNYOUGQ-UHFFFAOYSA-N |
| Density | 1.191g/cm3 (Cal.) |
|---|---|
| Boiling point | 314.861°C at 760 mmHg (Cal.) |
| Flash point | 127.419°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Dichloro-1,1,3,3-Tetramethylindan-5-Ol |