|
CAS#: 93893-05-1 Product: 2-Anilinoethyl p-Toluenesulphonate No suppilers available for the product. |
| Name | 2-Anilinoethyl p-Toluenesulphonate |
|---|---|
| Synonyms | 4-Methylbenzenesulfonic Acid 2-(Phenylamino)Ethyl Ester; 2-Anilinoethyl P-Toluenesulphonate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.36 |
| CAS Registry Number | 93893-05-1 |
| EINECS | 299-592-3 |
| SMILES | C2=C([S](OCCNC1=CC=CC=C1)(=O)=O)C=CC(=C2)C |
| InChI | 1S/C15H17NO3S/c1-13-7-9-15(10-8-13)20(17,18)19-12-11-16-14-5-3-2-4-6-14/h2-10,16H,11-12H2,1H3 |
| InChIKey | MUAUNBYVGHLRNE-UHFFFAOYSA-N |
| Density | 1.244g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.921°C at 760 mmHg (Cal.) |
| Flash point | 244.652°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Anilinoethyl p-Toluenesulphonate |