|
CAS#: 93893-68-6 Product: 4,4'-Methylenebis[1,1,3,3-tetramethyl-6-(2-methyl-2-propanyl)-5-indanol] No suppilers available for the product. |
| Name | 4,4'-Methylenebis[1,1,3,3-tetramethyl-6-(2-methyl-2-propanyl)-5-indanol] |
|---|---|
| Synonyms | 4,4'-meth |
| Molecular Structure | ![]() |
| Molecular Formula | C35H52O2 |
| Molecular Weight | 504.79 |
| CAS Registry Number | 93893-68-6 |
| EINECS | 299-659-7 |
| SMILES | CC(C)(C)c3cc4c(c(Cc1c(O)c(cc2c1C(C)(C)CC2(C)C)C(C)(C)C)c3O)C(C)(C)CC4(C)C |
| InChI | 1S/C35H52O2/c1-30(2,3)24-16-22-26(34(11,12)18-32(22,7)8)20(28(24)36)15-21-27-23(33(9,10)19-35(27,13)14)17-25(29(21)37)31(4,5)6/h16-17,36-37H,15,18-19H2,1-14H3 |
| InChIKey | YFVWRGVVIOMGGV-UHFFFAOYSA-N |
| Density | 0.988g/cm3 (Cal.) |
|---|---|
| Boiling point | 519.472°C at 760 mmHg (Cal.) |
| Flash point | 195.195°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Methylenebis[1,1,3,3-tetramethyl-6-(2-methyl-2-propanyl)-5-indanol] |