|
CAS#: 939-08-2 Product: 5-(4-Pyridyl)-1H-1,2,4-triazol-3(2H)-one No suppilers available for the product. |
| Name | 5-(4-Pyridyl)-1H-1,2,4-triazol-3(2H)-one |
|---|---|
| Synonyms | 5-(4-Pyridyl)-1,2-Dihydro-1,2,4-Triazol-3-One; 4H-1,2,4-Triazol-3-Ol, 5-(4-Pyridinyl)-; Aids-192902 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6N4O |
| Molecular Weight | 162.15 |
| CAS Registry Number | 939-08-2 |
| SMILES | C1=CC(=CC=N1)C2=NC(NN2)=O |
| InChI | 1S/C7H6N4O/c12-7-9-6(10-11-7)5-1-3-8-4-2-5/h1-4H,(H2,9,10,11,12) |
| InChIKey | UKPXYDJSESBHPR-UHFFFAOYSA-N |
| Density | 1.555g/cm3 (Cal.) |
|---|---|
| Boiling point | 508.9°C at 760 mmHg (Cal.) |
| Flash point | 261.6°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-(4-Pyridyl)-1H-1,2,4-triazol-3(2H)-one |